C9H19N2O5P — CID 87496174
(2S)-5-amino-2-(2-phosphonobut-3-enylamino)pentanoic acid (PubChem CID 87496174) has the molecular formula C9H19N2O5P and a molecular weight of 266.23 g/mol. Its IUPAC name is (2S)-5-amino-2-(2-phosphonobut-3-enylamino)pentanoic acid.
| Compound Name | (2S)-5-amino-2-(2-phosphonobut-3-enylamino)pentanoic acid |
|---|---|
| PubChem CID | 87496174 |
| Molecular Formula | C9H19N2O5P |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (2S)-5-amino-2-(2-phosphonobut-3-enylamino)pentanoic acid |
| SMILES | C=CC(CN[C@@H](CCCN)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H19N2O5P/c1-2-7(17(14,15)16)6-11-8(9(12)13)4-3-5-10/h2,7-8,11H,1,3-6,10H2,(H,12,13)(H2,14,15,16)/t7?,8-/m0/s1 |
| InChIKey | LIJNLUWHVKJLSH-MQWKRIRWSA-N |
| XLogP | -0.50 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|