C12H18N2O7 — CID 141447333
2-[[(1S)-5-amino-1-carboxypentyl]-prop-2-enoylamino]propanedioic acid (PubChem CID 141447333) has the molecular formula C12H18N2O7 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-[[(1S)-5-amino-1-carboxypentyl]-prop-2-enoylamino]propanedioic acid.
| Compound Name | 2-[[(1S)-5-amino-1-carboxypentyl]-prop-2-enoylamino]propanedioic acid |
|---|---|
| PubChem CID | 141447333 |
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[[(1S)-5-amino-1-carboxypentyl]-prop-2-enoylamino]propanedioic acid |
| SMILES | C=CC(=O)N(C(C(=O)O)C(=O)O)[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C12H18N2O7/c1-2-8(15)14(9(11(18)19)12(20)21)7(10(16)17)5-3-4-6-13/h2,7,9H,1,3-6,13H2,(H,16,17)(H,18,19)(H,20,21)/t7-/m0/s1 |
| InChIKey | LVVJKOBLIOORIH-ZETCQYMHSA-N |
| XLogP | -0.88 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|