C10H38N2O26P8 — CID 173046070
(2S)-2,6-diaminohexanoic acid;phosphonomethylphosphonic acid (PubChem CID 173046070) has the molecular formula C10H38N2O26P8 and a molecular weight of 850.19 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;phosphonomethylphosphonic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;phosphonomethylphosphonic acid |
|---|---|
| PubChem CID | 173046070 |
| Molecular Formula | C10H38N2O26P8 |
| Molecular Weight | 850.19 g/mol |
| Exact Mass | 849.96 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;phosphonomethylphosphonic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.O=P(O)(O)CP(=O)(O)O.O=P(O)(O)CP(=O)(O)O.O=P(O)(O)CP(=O)(O)O.O=P(O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C6H14N2O2.4CH6O6P2/c7-4-2-1-3-5(8)6(9)10;4*2-8(3,4)1-9(5,6)7/h5H,1-4,7-8H2,(H,9,10);4*1H2,(H2,2,3,4)(H2,5,6,7)/t5-;;;;/m0..../s1 |
| InChIKey | KLWDFQLIKFXHQV-OUTKXMMCSA-N |
| XLogP | -3.28 |
| TPSA | 549.58 Ų |
| H-Bond Donors | 19 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.19 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 19 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|