6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid

C12H27N3O6 — CID 135340868

IUPAC6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid
SMILESCCCCC(N)C(=O)O.NCCCCC(C(=O)O)N(O)O
InChIInChI=1S/C6H14N2O4.C6H13NO2/c7-4-2-1-3-5(6(9)10)8(11)12;1-2-3-4-5(7)6(8)9/h5,11-12H,1-4,7H2,(H,9,10);5H,2-4,7H2,1H3,(H,8,9)
InChIKeyLADRKNZAYANYMJ-UHFFFAOYSA-N
MW309.36 g/mol
LogP0.24
Rot. Bonds10

About 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid

6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid (PubChem CID 135340868) has the molecular formula C12H27N3O6 and a molecular weight of 309.36 g/mol. Its IUPAC name is 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid.

Molecular Properties

Compound Name6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid
PubChem CID135340868
Molecular FormulaC12H27N3O6
Molecular Weight309.36 g/mol
Exact Mass309.19
IUPAC Name6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid
SMILESCCCCC(N)C(=O)O.NCCCCC(C(=O)O)N(O)O
InChIInChI=1S/C6H14N2O4.C6H13NO2/c7-4-2-1-3-5(6(9)10)8(11)12;1-2-3-4-5(7)6(8)9/h5,11-12H,1-4,7H2,(H,9,10);5H,2-4,7H2,1H3,(H,8,9)
InChIKeyLADRKNZAYANYMJ-UHFFFAOYSA-N
XLogP0.24
TPSA170.34 Ų
H-Bond Donors6
H-Bond Acceptors7
Rotatable Bonds10
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500309.36
LogP ≤ 50.24
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid?
The IUPAC name of 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid (CID 135340868) is 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid.
What is the SMILES notation for 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid?
The canonical SMILES for 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid is CCCCC(N)C(=O)O.NCCCCC(C(=O)O)N(O)O.
What is the InChIKey of 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid?
The InChIKey is LADRKNZAYANYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O4.C6H13NO2/c7-4-2-1-3-5(6(9)10)8(11)12;1-2-3-4-5(7)6(8)9/h5,11-12H,1-4,7H2,(H,9,10);5H,2-4,7H2,1H3,(H,8,9).
What are the key properties of 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid?
6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid has a molecular weight of 309.36 g/mol, XLogP of 0.24, 10 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(dihydroxyamino)hexanoic acid;2-aminohexanoic acid is sourced from PubChem (CID 135340868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).