C9H24N2O14P4 — CID 22924885
2,5-bis[bis(phosphonomethyl)amino]pentanoic acid (PubChem CID 22924885) has the molecular formula C9H24N2O14P4 and a molecular weight of 508.19 g/mol. Its IUPAC name is 2,5-bis[bis(phosphonomethyl)amino]pentanoic acid.
| Compound Name | 2,5-bis[bis(phosphonomethyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 22924885 |
| Molecular Formula | C9H24N2O14P4 |
| Molecular Weight | 508.19 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 2,5-bis[bis(phosphonomethyl)amino]pentanoic acid |
| SMILES | O=C(O)C(CCCN(CP(=O)(O)O)CP(=O)(O)O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C9H24N2O14P4/c12-9(13)8(11(6-28(20,21)22)7-29(23,24)25)2-1-3-10(4-26(14,15)16)5-27(17,18)19/h8H,1-7H2,(H,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)(H2,23,24,25) |
| InChIKey | RLYUEKBMZOXKJV-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 273.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.19 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|