C6H13NO10P2 — CID 90023762
2-[carboxymethyl(phosphonomethyl)amino]-3-phosphonopropanoic acid (PubChem CID 90023762) has the molecular formula C6H13NO10P2 and a molecular weight of 321.12 g/mol. Its IUPAC name is 2-[carboxymethyl(phosphonomethyl)amino]-3-phosphonopropanoic acid.
| Compound Name | 2-[carboxymethyl(phosphonomethyl)amino]-3-phosphonopropanoic acid |
|---|---|
| PubChem CID | 90023762 |
| Molecular Formula | C6H13NO10P2 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 2-[carboxymethyl(phosphonomethyl)amino]-3-phosphonopropanoic acid |
| SMILES | O=C(O)CN(CP(=O)(O)O)C(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C6H13NO10P2/c8-5(9)1-7(3-19(15,16)17)4(6(10)11)2-18(12,13)14/h4H,1-3H2,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | RYEAGJQBCRIFAX-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 192.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|