C8H20N2O9P2 — CID 87463549
(2S,5R)-6-amino-2-[bis(phosphonomethyl)amino]-5-hydroxyhexanoic acid (PubChem CID 87463549) has the molecular formula C8H20N2O9P2 and a molecular weight of 350.20 g/mol. Its IUPAC name is (2S,5R)-6-amino-2-[bis(phosphonomethyl)amino]-5-hydroxyhexanoic acid.
| Compound Name | (2S,5R)-6-amino-2-[bis(phosphonomethyl)amino]-5-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 87463549 |
| Molecular Formula | C8H20N2O9P2 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (2S,5R)-6-amino-2-[bis(phosphonomethyl)amino]-5-hydroxyhexanoic acid |
| SMILES | NC[C@H](O)CC[C@@H](C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H20N2O9P2/c9-3-6(11)1-2-7(8(12)13)10(4-20(14,15)16)5-21(17,18)19/h6-7,11H,1-5,9H2,(H,12,13)(H2,14,15,16)(H2,17,18,19)/t6-,7+/m1/s1 |
| InChIKey | XXQWMNCNQQGTOA-RQJHMYQMSA-N |
| XLogP | -1.89 |
| TPSA | 201.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|