C7H17NO8P2 — CID 87461807
(2S)-2-[bis(phosphonomethyl)amino]-3-methylbutanoic acid (PubChem CID 87461807) has the molecular formula C7H17NO8P2 and a molecular weight of 305.16 g/mol. Its IUPAC name is (2S)-2-[bis(phosphonomethyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[bis(phosphonomethyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87461807 |
| Molecular Formula | C7H17NO8P2 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (2S)-2-[bis(phosphonomethyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C7H17NO8P2/c1-5(2)6(7(9)10)8(3-17(11,12)13)4-18(14,15)16/h5-6H,3-4H2,1-2H3,(H,9,10)(H2,11,12,13)(H2,14,15,16)/t6-/m0/s1 |
| InChIKey | GIIBVKMVUZIHBE-LURJTMIESA-N |
| XLogP | -0.33 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|