2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid

C11H23NO6 — CID 23364153

IUPAC2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)N(CC(O)CO)CC(O)CO
InChIInChI=1S/C11H23NO6/c1-7(2)10(11(17)18)12(3-8(15)5-13)4-9(16)6-14/h7-10,13-16H,3-6H2,1-2H3,(H,17,18)
InChIKeyQCTUYFLOOJKCFU-UHFFFAOYSA-N
MW265.31 g/mol
LogP-1.90
Rot. Bonds9

About 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid

2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid (PubChem CID 23364153) has the molecular formula C11H23NO6 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid.

Molecular Properties

Compound Name2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid
PubChem CID23364153
Molecular FormulaC11H23NO6
Molecular Weight265.31 g/mol
Exact Mass265.15
IUPAC Name2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)N(CC(O)CO)CC(O)CO
InChIInChI=1S/C11H23NO6/c1-7(2)10(11(17)18)12(3-8(15)5-13)4-9(16)6-14/h7-10,13-16H,3-6H2,1-2H3,(H,17,18)
InChIKeyQCTUYFLOOJKCFU-UHFFFAOYSA-N
XLogP-1.90
TPSA121.46 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 5-1.90
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid?
The IUPAC name of 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid (CID 23364153) is 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid.
What is the SMILES notation for 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid?
The canonical SMILES for 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid is CC(C)C(C(=O)O)N(CC(O)CO)CC(O)CO.
What is the InChIKey of 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid?
The InChIKey is QCTUYFLOOJKCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO6/c1-7(2)10(11(17)18)12(3-8(15)5-13)4-9(16)6-14/h7-10,13-16H,3-6H2,1-2H3,(H,17,18).
What are the key properties of 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid?
2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid has a molecular weight of 265.31 g/mol, XLogP of -1.90, 9 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid is sourced from PubChem (CID 23364153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).