C11H23NO6 — CID 23364153
2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid (PubChem CID 23364153) has the molecular formula C11H23NO6 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 23364153 |
| Molecular Formula | C11H23NO6 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[bis(2,3-dihydroxypropyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(CC(O)CO)CC(O)CO |
| InChI | InChI=1S/C11H23NO6/c1-7(2)10(11(17)18)12(3-8(15)5-13)4-9(16)6-14/h7-10,13-16H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | QCTUYFLOOJKCFU-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |