C17H22I3N3O7 — CID 12940863
3-N,5-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N,5-N-dimethylbenzene-1,3,5-tricarboxamide (PubChem CID 12940863) has the molecular formula C17H22I3N3O7 and a molecular weight of 761.09 g/mol. Its IUPAC name is 3-N,5-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N,5-N-dimethylbenzene-1,3,5-tricarboxamide.
| Compound Name | 3-N,5-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N,5-N-dimethylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 12940863 |
| Molecular Formula | C17H22I3N3O7 |
| Molecular Weight | 761.09 g/mol |
| Exact Mass | 760.86 |
| IUPAC Name | 3-N,5-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N,5-N-dimethylbenzene-1,3,5-tricarboxamide |
| SMILES | CN(CC(O)CO)C(=O)c1c(I)c(C(N)=O)c(I)c(C(=O)N(C)CC(O)CO)c1I |
| InChI | InChI=1S/C17H22I3N3O7/c1-22(3-7(26)5-24)16(29)10-12(18)9(15(21)28)13(19)11(14(10)20)17(30)23(2)4-8(27)6-25/h7-8,24-27H,3-6H2,1-2H3,(H2,21,28) |
| InChIKey | LMFURNFTZPNWJT-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.09 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|