C38H54I6N6O16Se — CID 88741950
bis(5-amino-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide);3-(2-carboxyethylselanyl)propanoic acid (PubChem CID 88741950) has the molecular formula C38H54I6N6O16Se and a molecular weight of 1691.26 g/mol. Its IUPAC name is bis(5-amino-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide);3-(2-carboxyethylselanyl)propanoic acid.
| Compound Name | bis(5-amino-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide);3-(2-carboxyethylselanyl)propanoic acid |
|---|---|
| PubChem CID | 88741950 |
| Molecular Formula | C38H54I6N6O16Se |
| Molecular Weight | 1691.26 g/mol |
| Exact Mass | 1691.70 |
| IUPAC Name | bis(5-amino-1-N,3-N-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-N,3-N-dimethylbenzene-1,3-dicarboxamide);3-(2-carboxyethylselanyl)propanoic acid |
| SMILES | CN(CC(O)CO)C(=O)c1c(I)c(N)c(I)c(C(=O)N(C)CC(O)CO)c1I.CN(CC(O)CO)C(=O)c1c(I)c(N)c(I)c(C(=O)N(C)CC(O)CO)c1I.O=C(O)CC[Se]CCC(=O)O |
| InChI | InChI=1S/2C16H22I3N3O6.C6H10O4Se/c2*1-21(3-7(25)5-23)15(27)9-11(17)10(13(19)14(20)12(9)18)16(28)22(2)4-8(26)6-24;7-5(8)1-3-11-4-2-6(9)10/h2*7-8,23-26H,3-6,20H2,1-2H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | QTSPBGFFNLNULT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 369.72 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1691.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|