C33H44I6N6O18 — CID 88511721
bis(5-amino-1-N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N-methyl-3-N-(1,2,3-trihydroxypropyl)benzene-1,3-dicarboxamide);propanedioic acid (PubChem CID 88511721) has the molecular formula C33H44I6N6O18 and a molecular weight of 1574.16 g/mol. Its IUPAC name is bis(5-amino-1-N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N-methyl-3-N-(1,2,3-trihydroxypropyl)benzene-1,3-dicarboxamide);propanedioic acid.
| Compound Name | bis(5-amino-1-N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N-methyl-3-N-(1,2,3-trihydroxypropyl)benzene-1,3-dicarboxamide);propanedioic acid |
|---|---|
| PubChem CID | 88511721 |
| Molecular Formula | C33H44I6N6O18 |
| Molecular Weight | 1574.16 g/mol |
| Exact Mass | 1573.70 |
| IUPAC Name | bis(5-amino-1-N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-N-methyl-3-N-(1,2,3-trihydroxypropyl)benzene-1,3-dicarboxamide);propanedioic acid |
| SMILES | CN(C(=O)c1c(I)c(N)c(I)c(C(=O)NCC(O)CO)c1I)C(O)C(O)CO.CN(C(=O)c1c(I)c(N)c(I)c(C(=O)NCC(O)CO)c1I)C(O)C(O)CO.O=C(O)CC(=O)O |
| InChI | InChI=1S/2C15H20I3N3O7.C3H4O4/c2*1-21(14(27)6(25)4-23)15(28)8-9(16)7(10(17)12(19)11(8)18)13(26)20-2-5(24)3-22;4-2(5)1-3(6)7/h2*5-6,14,22-25,27H,2-4,19H2,1H3,(H,20,26);1H2,(H,4,5)(H,6,7) |
| InChIKey | HUOPYDIWQVZMQN-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 427.76 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1574.16 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|