C18H26I3NO11 — CID 139614496
N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3,5-bis(2,3,4-trihydroxybutoxy)benzamide (PubChem CID 139614496) has the molecular formula C18H26I3NO11 and a molecular weight of 813.11 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3,5-bis(2,3,4-trihydroxybutoxy)benzamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3,5-bis(2,3,4-trihydroxybutoxy)benzamide |
|---|---|
| PubChem CID | 139614496 |
| Molecular Formula | C18H26I3NO11 |
| Molecular Weight | 813.11 g/mol |
| Exact Mass | 812.86 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3,5-bis(2,3,4-trihydroxybutoxy)benzamide |
| SMILES | O=C(NCC(O)CO)c1c(I)c(OCC(O)C(O)CO)c(I)c(OCC(O)C(O)CO)c1I |
| InChI | InChI=1S/C18H26I3NO11/c19-13-12(18(31)22-1-7(26)2-23)14(20)17(33-6-11(30)9(28)4-25)15(21)16(13)32-5-10(29)8(27)3-24/h7-11,23-30H,1-6H2,(H,22,31) |
| InChIKey | GIPAZYRWLDAJKL-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 209.40 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.11 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|