C14H16I3NO5 — CID 141409901
N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-(2-methoxyacetyl)-N-methylbenzamide (PubChem CID 141409901) has the molecular formula C14H16I3NO5 and a molecular weight of 659.00 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-(2-methoxyacetyl)-N-methylbenzamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-(2-methoxyacetyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 141409901 |
| Molecular Formula | C14H16I3NO5 |
| Molecular Weight | 659.00 g/mol |
| Exact Mass | 658.82 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2,4,6-triiodo-3-(2-methoxyacetyl)-N-methylbenzamide |
| SMILES | COCC(=O)c1c(I)cc(I)c(C(=O)N(C)CC(O)CO)c1I |
| InChI | InChI=1S/C14H16I3NO5/c1-18(4-7(20)5-19)14(22)12-9(16)3-8(15)11(13(12)17)10(21)6-23-2/h3,7,19-20H,4-6H2,1-2H3 |
| InChIKey | KYGBVKCUSIIHLE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.00 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|