C14H14I3NO8 — CID 160687485
5-[2-[2,3-dihydroxypropyl(methyl)amino]-2-oxoethoxy]-2,4,6-triiodobenzene-1,3-dicarboxylic acid (PubChem CID 160687485) has the molecular formula C14H14I3NO8 and a molecular weight of 704.98 g/mol. Its IUPAC name is 5-[2-[2,3-dihydroxypropyl(methyl)amino]-2-oxoethoxy]-2,4,6-triiodobenzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-[2,3-dihydroxypropyl(methyl)amino]-2-oxoethoxy]-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 160687485 |
| Molecular Formula | C14H14I3NO8 |
| Molecular Weight | 704.98 g/mol |
| Exact Mass | 704.79 |
| IUPAC Name | 5-[2-[2,3-dihydroxypropyl(methyl)amino]-2-oxoethoxy]-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
| SMILES | CN(CC(O)CO)C(=O)COc1c(I)c(C(=O)O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C14H14I3NO8/c1-18(2-5(20)3-19)6(21)4-26-12-10(16)7(13(22)23)9(15)8(11(12)17)14(24)25/h5,19-20H,2-4H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | ROYMDIZBBHRJLG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.98 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|