C23H34I3N3O12 — CID 123591302
ethyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate (PubChem CID 123591302) has the molecular formula C23H34I3N3O12 and a molecular weight of 925.25 g/mol. Its IUPAC name is ethyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate.
| Compound Name | ethyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate |
|---|---|
| PubChem CID | 123591302 |
| Molecular Formula | C23H34I3N3O12 |
| Molecular Weight | 925.25 g/mol |
| Exact Mass | 924.93 |
| IUPAC Name | ethyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate |
| SMILES | CCOC(=O)Nc1c(I)c(C(=O)N(CC(O)CO)CC(O)CO)c(I)c(C(=O)N(CC(O)CO)CC(O)CO)c1I |
| InChI | InChI=1S/C23H34I3N3O12/c1-2-41-23(40)27-20-18(25)15(21(38)28(3-11(34)7-30)4-12(35)8-31)17(24)16(19(20)26)22(39)29(5-13(36)9-32)6-14(37)10-33/h11-14,30-37H,2-10H2,1H3,(H,27,40) |
| InChIKey | NOWMQTFQDDYZRB-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 240.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|