C24H36I3N3O13 — CID 89185880
3-hydroxypropyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate (PubChem CID 89185880) has the molecular formula C24H36I3N3O13 and a molecular weight of 955.27 g/mol. Its IUPAC name is 3-hydroxypropyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate.
| Compound Name | 3-hydroxypropyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate |
|---|---|
| PubChem CID | 89185880 |
| Molecular Formula | C24H36I3N3O13 |
| Molecular Weight | 955.27 g/mol |
| Exact Mass | 954.94 |
| IUPAC Name | 3-hydroxypropyl N-[3,5-bis[bis(2,3-dihydroxypropyl)carbamoyl]-2,4,6-triiodophenyl]carbamate |
| SMILES | O=C(Nc1c(I)c(C(=O)N(CC(O)CO)CC(O)CO)c(I)c(C(=O)N(CC(O)CO)CC(O)CO)c1I)OCCCO |
| InChI | InChI=1S/C24H36I3N3O13/c25-18-16(22(40)29(4-12(36)8-32)5-13(37)9-33)19(26)21(28-24(42)43-3-1-2-31)20(27)17(18)23(41)30(6-14(38)10-34)7-15(39)11-35/h12-15,31-39H,1-11H2,(H,28,42) |
| InChIKey | LXDMDCUISLMAJK-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 261.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.27 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|