C5H10INO3 — CID 154525602
N-(2,3-dihydroxypropyl)-N-methylcarbamoyl iodide (PubChem CID 154525602) has the molecular formula C5H10INO3 and a molecular weight of 259.04 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-N-methylcarbamoyl iodide.
| Compound Name | N-(2,3-dihydroxypropyl)-N-methylcarbamoyl iodide |
|---|---|
| PubChem CID | 154525602 |
| Molecular Formula | C5H10INO3 |
| Molecular Weight | 259.04 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-N-methylcarbamoyl iodide |
| SMILES | CN(CC(O)CO)C(=O)I |
| InChI | InChI=1S/C5H10INO3/c1-7(5(6)10)2-4(9)3-8/h4,8-9H,2-3H2,1H3 |
| InChIKey | KFWPBBPZIKCJJT-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.04 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|