C18H28N2O6 — CID 143787605
3-(2,3-dihydroxypropanoylamino)-N-(2,3-dihydroxypropyl)-N,2,4,5,6-pentamethylbenzamide (PubChem CID 143787605) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropanoylamino)-N-(2,3-dihydroxypropyl)-N,2,4,5,6-pentamethylbenzamide.
| Compound Name | 3-(2,3-dihydroxypropanoylamino)-N-(2,3-dihydroxypropyl)-N,2,4,5,6-pentamethylbenzamide |
|---|---|
| PubChem CID | 143787605 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 3-(2,3-dihydroxypropanoylamino)-N-(2,3-dihydroxypropyl)-N,2,4,5,6-pentamethylbenzamide |
| SMILES | Cc1c(C)c(NC(=O)C(O)CO)c(C)c(C(=O)N(C)CC(O)CO)c1C |
| InChI | InChI=1S/C18H28N2O6/c1-9-10(2)15(18(26)20(5)6-13(23)7-21)12(4)16(11(9)3)19-17(25)14(24)8-22/h13-14,21-24H,6-8H2,1-5H3,(H,19,25) |
| InChIKey | RPKPANSLLZJNNC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |