C22H36N4O7 — CID 143787631
3-N-(2,3-dihydroxypropyl)-1-N-[2-[2,3-dihydroxypropyl(formyl)amino]ethyl]-3-N,2,4,6-tetramethyl-5-(methylamino)benzene-1,3-dicarboxamide (PubChem CID 143787631) has the molecular formula C22H36N4O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-N-(2,3-dihydroxypropyl)-1-N-[2-[2,3-dihydroxypropyl(formyl)amino]ethyl]-3-N,2,4,6-tetramethyl-5-(methylamino)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2,3-dihydroxypropyl)-1-N-[2-[2,3-dihydroxypropyl(formyl)amino]ethyl]-3-N,2,4,6-tetramethyl-5-(methylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 143787631 |
| Molecular Formula | C22H36N4O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 3-N-(2,3-dihydroxypropyl)-1-N-[2-[2,3-dihydroxypropyl(formyl)amino]ethyl]-3-N,2,4,6-tetramethyl-5-(methylamino)benzene-1,3-dicarboxamide |
| SMILES | CNc1c(C)c(C(=O)NCCN(C=O)CC(O)CO)c(C)c(C(=O)N(C)CC(O)CO)c1C |
| InChI | InChI=1S/C22H36N4O7/c1-13-18(21(32)24-6-7-26(12-29)9-17(31)11-28)14(2)20(23-4)15(3)19(13)22(33)25(5)8-16(30)10-27/h12,16-17,23,27-28,30-31H,6-11H2,1-5H3,(H,24,32) |
| InChIKey | IAHRZOBWQFBNEO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|