C6H13NO3 — CID 21025486
3,4-dihydroxy-N,N-dimethylbutanamide (PubChem CID 21025486) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is 3,4-dihydroxy-N,N-dimethylbutanamide.
| Compound Name | 3,4-dihydroxy-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 21025486 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 3,4-dihydroxy-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CC(O)CO |
| InChI | InChI=1S/C6H13NO3/c1-7(2)6(10)3-5(9)4-8/h5,8-9H,3-4H2,1-2H3 |
| InChIKey | PWOOGLMJAWKADO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |