C9H18N2O4 — CID 87632154
(3R,5R)-3,5-dihydroxy-N',N'-dimethylheptanediamide (PubChem CID 87632154) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is (3R,5R)-3,5-dihydroxy-N',N'-dimethylheptanediamide.
| Compound Name | (3R,5R)-3,5-dihydroxy-N',N'-dimethylheptanediamide |
|---|---|
| PubChem CID | 87632154 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (3R,5R)-3,5-dihydroxy-N',N'-dimethylheptanediamide |
| SMILES | CN(C)C(=O)C[C@H](O)C[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C9H18N2O4/c1-11(2)9(15)5-7(13)3-6(12)4-8(10)14/h6-7,12-13H,3-5H2,1-2H3,(H2,10,14)/t6-,7-/m1/s1 |
| InChIKey | ALXPATULIQOHMR-RNFRBKRXSA-N |
| XLogP | -1.55 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |