C13H27NO2 — CID 175454513
5-ethyl-3-hydroxy-N,N-dimethylnonanamide (PubChem CID 175454513) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 5-ethyl-3-hydroxy-N,N-dimethylnonanamide.
| Compound Name | 5-ethyl-3-hydroxy-N,N-dimethylnonanamide |
|---|---|
| PubChem CID | 175454513 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 5-ethyl-3-hydroxy-N,N-dimethylnonanamide |
| SMILES | CCCCC(CC)CC(O)CC(=O)N(C)C |
| InChI | InChI=1S/C13H27NO2/c1-5-7-8-11(6-2)9-12(15)10-13(16)14(3)4/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | VKZAEKBQIOEYGJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |