About 4-ethyltridecane-1,2-diol
4-ethyltridecane-1,2-diol (PubChem CID 174824955) has the molecular formula C15H32O2
and a molecular weight of 244.42 g/mol. Its IUPAC name is 4-ethyltridecane-1,2-diol.
Molecular Properties
| Compound Name | 4-ethyltridecane-1,2-diol |
| PubChem CID | 174824955 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 4-ethyltridecane-1,2-diol |
| SMILES | CCCCCCCCCC(CC)CC(O)CO |
| InChI | InChI=1S/C15H32O2/c1-3-5-6-7-8-9-10-11-14(4-2)12-15(17)13-16/h14-17H,3-13H2,1-2H3 |
| InChIKey | LZQABFDNTXAFTE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyltridecane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyltridecane-1,2-diol?
The IUPAC name of 4-ethyltridecane-1,2-diol (CID 174824955) is 4-ethyltridecane-1,2-diol.
What is the SMILES notation for 4-ethyltridecane-1,2-diol?
The canonical SMILES for 4-ethyltridecane-1,2-diol is CCCCCCCCCC(CC)CC(O)CO.
What is the InChIKey of 4-ethyltridecane-1,2-diol?
The InChIKey is LZQABFDNTXAFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O2/c1-3-5-6-7-8-9-10-11-14(4-2)12-15(17)13-16/h14-17H,3-13H2,1-2H3.
What are the key properties of 4-ethyltridecane-1,2-diol?
4-ethyltridecane-1,2-diol has a molecular weight of 244.42 g/mol, XLogP of 3.90, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyltridecane-1,2-diol is sourced from PubChem (CID 174824955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).