About 9-hexylheptadecan-7-ol
9-hexylheptadecan-7-ol (PubChem CID 19871685) has the molecular formula C23H48O
and a molecular weight of 340.64 g/mol. Its IUPAC name is 9-hexylheptadecan-7-ol.
Molecular Properties
| Compound Name | 9-hexylheptadecan-7-ol |
| PubChem CID | 19871685 |
| Molecular Formula | C23H48O |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.37 |
| IUPAC Name | 9-hexylheptadecan-7-ol |
| SMILES | CCCCCCCCC(CCCCCC)CC(O)CCCCCC |
| InChI | InChI=1S/C23H48O/c1-4-7-10-13-14-16-19-22(18-15-11-8-5-2)21-23(24)20-17-12-9-6-3/h22-24H,4-21H2,1-3H3 |
| InChIKey | FLTZAFGWUAWMAJ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-hexylheptadecan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hexylheptadecan-7-ol?
The IUPAC name of 9-hexylheptadecan-7-ol (CID 19871685) is 9-hexylheptadecan-7-ol.
What is the SMILES notation for 9-hexylheptadecan-7-ol?
The canonical SMILES for 9-hexylheptadecan-7-ol is CCCCCCCCC(CCCCCC)CC(O)CCCCCC.
What is the InChIKey of 9-hexylheptadecan-7-ol?
The InChIKey is FLTZAFGWUAWMAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48O/c1-4-7-10-13-14-16-19-22(18-15-11-8-5-2)21-23(24)20-17-12-9-6-3/h22-24H,4-21H2,1-3H3.
What are the key properties of 9-hexylheptadecan-7-ol?
9-hexylheptadecan-7-ol has a molecular weight of 340.64 g/mol, XLogP of 8.05, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hexylheptadecan-7-ol is sourced from PubChem (CID 19871685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).