C7H14N2O2 — CID 89208905
(2S)-N,N,2-trimethylbutanediamide (PubChem CID 89208905) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (2S)-N,N,2-trimethylbutanediamide.
| Compound Name | (2S)-N,N,2-trimethylbutanediamide |
|---|---|
| PubChem CID | 89208905 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (2S)-N,N,2-trimethylbutanediamide |
| SMILES | C[C@@H](CC(N)=O)C(=O)N(C)C |
| InChI | InChI=1S/C7H14N2O2/c1-5(4-6(8)10)7(11)9(2)3/h5H,4H2,1-3H3,(H2,8,10)/t5-/m0/s1 |
| InChIKey | CIOVBSUXVSBPIC-YFKPBYRVSA-N |
| XLogP | -0.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |