C6H10N2O5 — CID 175100388
(2S)-4-amino-2-[carboxy(methyl)amino]-4-oxobutanoic acid (PubChem CID 175100388) has the molecular formula C6H10N2O5 and a molecular weight of 190.15 g/mol. Its IUPAC name is (2S)-4-amino-2-[carboxy(methyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[carboxy(methyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175100388 |
| Molecular Formula | C6H10N2O5 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2S)-4-amino-2-[carboxy(methyl)amino]-4-oxobutanoic acid |
| SMILES | CN(C(=O)O)[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C6H10N2O5/c1-8(6(12)13)3(5(10)11)2-4(7)9/h3H,2H2,1H3,(H2,7,9)(H,10,11)(H,12,13)/t3-/m0/s1 |
| InChIKey | GEVYBUGFYZBAEF-VKHMYHEASA-N |
| XLogP | -1.08 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |