C13H26N2O2 — CID 176616493
(3S)-3-[tert-butyl(methyl)amino]-5,5-dimethyl-4-oxohexanamide (PubChem CID 176616493) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(methyl)amino]-5,5-dimethyl-4-oxohexanamide.
| Compound Name | (3S)-3-[tert-butyl(methyl)amino]-5,5-dimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 176616493 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (3S)-3-[tert-butyl(methyl)amino]-5,5-dimethyl-4-oxohexanamide |
| SMILES | CN([C@@H](CC(N)=O)C(=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-12(2,3)11(17)9(8-10(14)16)15(7)13(4,5)6/h9H,8H2,1-7H3,(H2,14,16)/t9-/m0/s1 |
| InChIKey | GFSPOTCVEKDFOC-VIFPVBQESA-N |
| XLogP | 1.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |