C10H23N3O — CID 66429453
4-amino-3-[2,2-dimethylpropyl(methyl)amino]butanamide (PubChem CID 66429453) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-amino-3-[2,2-dimethylpropyl(methyl)amino]butanamide.
| Compound Name | 4-amino-3-[2,2-dimethylpropyl(methyl)amino]butanamide |
|---|---|
| PubChem CID | 66429453 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 4-amino-3-[2,2-dimethylpropyl(methyl)amino]butanamide |
| SMILES | CN(CC(C)(C)C)C(CN)CC(N)=O |
| InChI | InChI=1S/C10H23N3O/c1-10(2,3)7-13(4)8(6-11)5-9(12)14/h8H,5-7,11H2,1-4H3,(H2,12,14) |
| InChIKey | DZBXJZWCXGYUSV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |