C10H23N2OP — CID 142005602
3-(dimethylaminophosphanyl)-5,5-dimethylhexanamide (PubChem CID 142005602) has the molecular formula C10H23N2OP and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-(dimethylaminophosphanyl)-5,5-dimethylhexanamide.
| Compound Name | 3-(dimethylaminophosphanyl)-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 142005602 |
| Molecular Formula | C10H23N2OP |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-(dimethylaminophosphanyl)-5,5-dimethylhexanamide |
| SMILES | CN(C)PC(CC(N)=O)CC(C)(C)C |
| InChI | InChI=1S/C10H23N2OP/c1-10(2,3)7-8(6-9(11)13)14-12(4)5/h8,14H,6-7H2,1-5H3,(H2,11,13) |
| InChIKey | DHGDHLHKKXMYKT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|