C6H15NO7P2 — CID 22966765
(3-carbamoyl-2-phosphonopentan-2-yl)phosphonic acid (PubChem CID 22966765) has the molecular formula C6H15NO7P2 and a molecular weight of 275.13 g/mol. Its IUPAC name is (3-carbamoyl-2-phosphonopentan-2-yl)phosphonic acid.
| Compound Name | (3-carbamoyl-2-phosphonopentan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 22966765 |
| Molecular Formula | C6H15NO7P2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (3-carbamoyl-2-phosphonopentan-2-yl)phosphonic acid |
| SMILES | CCC(C(N)=O)C(C)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H15NO7P2/c1-3-4(5(7)8)6(2,15(9,10)11)16(12,13)14/h4H,3H2,1-2H3,(H2,7,8)(H2,9,10,11)(H2,12,13,14) |
| InChIKey | HCRWVDREUBNMTD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|