3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid

C10H19O7P — CID 54412153

IUPAC3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid
SMILESCCC(C(=O)OC)C(CC)(C(=O)OC)P(=O)(O)O
InChIInChI=1S/C10H19O7P/c1-5-7(8(11)16-3)10(6-2,9(12)17-4)18(13,14)15/h7H,5-6H2,1-4H3,(H2,13,14,15)
InChIKeyVUWVCWHZLOQNHS-UHFFFAOYSA-N
MW282.23 g/mol
LogP0.69
Rot. Bonds6

About 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid

3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid (PubChem CID 54412153) has the molecular formula C10H19O7P and a molecular weight of 282.23 g/mol. Its IUPAC name is 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid.

Molecular Properties

Compound Name3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid
PubChem CID54412153
Molecular FormulaC10H19O7P
Molecular Weight282.23 g/mol
Exact Mass282.09
IUPAC Name3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid
SMILESCCC(C(=O)OC)C(CC)(C(=O)OC)P(=O)(O)O
InChIInChI=1S/C10H19O7P/c1-5-7(8(11)16-3)10(6-2,9(12)17-4)18(13,14)15/h7H,5-6H2,1-4H3,(H2,13,14,15)
InChIKeyVUWVCWHZLOQNHS-UHFFFAOYSA-N
XLogP0.69
TPSA110.13 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.23
LogP ≤ 50.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid?
The IUPAC name of 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid (CID 54412153) is 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid.
What is the SMILES notation for 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid?
The canonical SMILES for 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid is CCC(C(=O)OC)C(CC)(C(=O)OC)P(=O)(O)O.
What is the InChIKey of 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid?
The InChIKey is VUWVCWHZLOQNHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19O7P/c1-5-7(8(11)16-3)10(6-2,9(12)17-4)18(13,14)15/h7H,5-6H2,1-4H3,(H2,13,14,15).
What are the key properties of 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid?
3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid has a molecular weight of 282.23 g/mol, XLogP of 0.69, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid is sourced from PubChem (CID 54412153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).