C10H19O7P — CID 54412153
3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid (PubChem CID 54412153) has the molecular formula C10H19O7P and a molecular weight of 282.23 g/mol. Its IUPAC name is 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid.
| Compound Name | 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 54412153 |
| Molecular Formula | C10H19O7P |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3,4-bis(methoxycarbonyl)hexan-3-ylphosphonic acid |
| SMILES | CCC(C(=O)OC)C(CC)(C(=O)OC)P(=O)(O)O |
| InChI | InChI=1S/C10H19O7P/c1-5-7(8(11)16-3)10(6-2,9(12)17-4)18(13,14)15/h7H,5-6H2,1-4H3,(H2,13,14,15) |
| InChIKey | VUWVCWHZLOQNHS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|