C16H31O7P — CID 23462690
(7-ethoxy-3-ethoxycarbonyl-4-ethyl-5,5-dimethyl-7-oxoheptan-3-yl)phosphonic acid (PubChem CID 23462690) has the molecular formula C16H31O7P and a molecular weight of 366.39 g/mol. Its IUPAC name is (7-ethoxy-3-ethoxycarbonyl-4-ethyl-5,5-dimethyl-7-oxoheptan-3-yl)phosphonic acid.
| Compound Name | (7-ethoxy-3-ethoxycarbonyl-4-ethyl-5,5-dimethyl-7-oxoheptan-3-yl)phosphonic acid |
|---|---|
| PubChem CID | 23462690 |
| Molecular Formula | C16H31O7P |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (7-ethoxy-3-ethoxycarbonyl-4-ethyl-5,5-dimethyl-7-oxoheptan-3-yl)phosphonic acid |
| SMILES | CCOC(=O)CC(C)(C)C(CC)C(CC)(C(=O)OCC)P(=O)(O)O |
| InChI | InChI=1S/C16H31O7P/c1-7-12(15(5,6)11-13(17)22-9-3)16(8-2,24(19,20)21)14(18)23-10-4/h12H,7-11H2,1-6H3,(H2,19,20,21) |
| InChIKey | GANQBAHHOPIKGM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|