(4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid

C8H17O5P — CID 87358725

IUPAC(4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid
SMILESCCOC(=O)C(C)(C)CCP(=O)(O)O
InChIInChI=1S/C8H17O5P/c1-4-13-7(9)8(2,3)5-6-14(10,11)12/h4-6H2,1-3H3,(H2,10,11,12)
InChIKeyGLRXIQUHBQYJJA-UHFFFAOYSA-N
MW224.19 g/mol
LogP1.14
Rot. Bonds5

About (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid

(4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid (PubChem CID 87358725) has the molecular formula C8H17O5P and a molecular weight of 224.19 g/mol. Its IUPAC name is (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid.

Molecular Properties

Compound Name(4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid
PubChem CID87358725
Molecular FormulaC8H17O5P
Molecular Weight224.19 g/mol
Exact Mass224.08
IUPAC Name(4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid
SMILESCCOC(=O)C(C)(C)CCP(=O)(O)O
InChIInChI=1S/C8H17O5P/c1-4-13-7(9)8(2,3)5-6-14(10,11)12/h4-6H2,1-3H3,(H2,10,11,12)
InChIKeyGLRXIQUHBQYJJA-UHFFFAOYSA-N
XLogP1.14
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.19
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid?
The IUPAC name of (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid (CID 87358725) is (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid.
What is the SMILES notation for (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid?
The canonical SMILES for (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid is CCOC(=O)C(C)(C)CCP(=O)(O)O.
What is the InChIKey of (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid?
The InChIKey is GLRXIQUHBQYJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O5P/c1-4-13-7(9)8(2,3)5-6-14(10,11)12/h4-6H2,1-3H3,(H2,10,11,12).
What are the key properties of (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid?
(4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid has a molecular weight of 224.19 g/mol, XLogP of 1.14, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-3,3-dimethyl-4-oxobutyl)phosphonic acid is sourced from PubChem (CID 87358725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).