C15H26O7 — CID 87257255
ethyl 3-(3-ethoxy-2,2-dimethyl-3-oxopropoxy)carbonyloxy-2,2-dimethylpropanoate (PubChem CID 87257255) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethyl 3-(3-ethoxy-2,2-dimethyl-3-oxopropoxy)carbonyloxy-2,2-dimethylpropanoate.
| Compound Name | ethyl 3-(3-ethoxy-2,2-dimethyl-3-oxopropoxy)carbonyloxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87257255 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | ethyl 3-(3-ethoxy-2,2-dimethyl-3-oxopropoxy)carbonyloxy-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)COC(=O)OCC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C15H26O7/c1-7-19-11(16)14(3,4)9-21-13(18)22-10-15(5,6)12(17)20-8-2/h7-10H2,1-6H3 |
| InChIKey | KDZBUZXQDGOCBY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|