C11H19ClO3 — CID 134256135
ethyl 5-chloro-2,2,4,4-tetramethyl-5-oxopentanoate (PubChem CID 134256135) has the molecular formula C11H19ClO3 and a molecular weight of 234.72 g/mol. Its IUPAC name is ethyl 5-chloro-2,2,4,4-tetramethyl-5-oxopentanoate.
| Compound Name | ethyl 5-chloro-2,2,4,4-tetramethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 134256135 |
| Molecular Formula | C11H19ClO3 |
| Molecular Weight | 234.72 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | ethyl 5-chloro-2,2,4,4-tetramethyl-5-oxopentanoate |
| SMILES | CCOC(=O)C(C)(C)CC(C)(C)C(=O)Cl |
| InChI | InChI=1S/C11H19ClO3/c1-6-15-9(14)11(4,5)7-10(2,3)8(12)13/h6-7H2,1-5H3 |
| InChIKey | POTSSVVRTYUQEK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|