C12H21BrO4 — CID 147985446
ethyl 4-bromo-7-hydroxy-2,2,4-trimethyl-5-oxoheptanoate (PubChem CID 147985446) has the molecular formula C12H21BrO4 and a molecular weight of 309.20 g/mol. Its IUPAC name is ethyl 4-bromo-7-hydroxy-2,2,4-trimethyl-5-oxoheptanoate.
| Compound Name | ethyl 4-bromo-7-hydroxy-2,2,4-trimethyl-5-oxoheptanoate |
|---|---|
| PubChem CID | 147985446 |
| Molecular Formula | C12H21BrO4 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | ethyl 4-bromo-7-hydroxy-2,2,4-trimethyl-5-oxoheptanoate |
| SMILES | CCOC(=O)C(C)(C)CC(C)(Br)C(=O)CCO |
| InChI | InChI=1S/C12H21BrO4/c1-5-17-10(16)11(2,3)8-12(4,13)9(15)6-7-14/h14H,5-8H2,1-4H3 |
| InChIKey | IUAVIRMRFHXPKM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|