About ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid
ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid (PubChem CID 175314045) has the molecular formula C9H18O6
and a molecular weight of 222.24 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid |
| PubChem CID | 175314045 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid |
| SMILES | CCOC(=O)C(C)(C)O.O=C(O)CCO |
| InChI | InChI=1S/C6H12O3.C3H6O3/c1-4-9-5(7)6(2,3)8;4-2-1-3(5)6/h8H,4H2,1-3H3;4H,1-2H2,(H,5,6) |
| InChIKey | LSQTZFWWBABXDG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid?
The IUPAC name of ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid (CID 175314045) is ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid.
What is the SMILES notation for ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid?
The canonical SMILES for ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid is CCOC(=O)C(C)(C)O.O=C(O)CCO.
What is the InChIKey of ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid?
The InChIKey is LSQTZFWWBABXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C3H6O3/c1-4-9-5(7)6(2,3)8;4-2-1-3(5)6/h8H,4H2,1-3H3;4H,1-2H2,(H,5,6).
What are the key properties of ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid?
ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid has a molecular weight of 222.24 g/mol, XLogP of -0.23, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-2-methylpropanoate;3-hydroxypropanoic acid is sourced from PubChem (CID 175314045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).