C16H26Br2O6 — CID 153452980
1-O-[2-(2-bromo-2-methylpropanoyl)oxyethyl] 5-O-ethyl 2-bromo-2,4,4-trimethylpentanedioate (PubChem CID 153452980) has the molecular formula C16H26Br2O6 and a molecular weight of 474.19 g/mol. Its IUPAC name is 1-O-[2-(2-bromo-2-methylpropanoyl)oxyethyl] 5-O-ethyl 2-bromo-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-(2-bromo-2-methylpropanoyl)oxyethyl] 5-O-ethyl 2-bromo-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 153452980 |
| Molecular Formula | C16H26Br2O6 |
| Molecular Weight | 474.19 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | 1-O-[2-(2-bromo-2-methylpropanoyl)oxyethyl] 5-O-ethyl 2-bromo-2,4,4-trimethylpentanedioate |
| SMILES | CCOC(=O)C(C)(C)CC(C)(Br)C(=O)OCCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C16H26Br2O6/c1-7-22-11(19)14(2,3)10-16(6,18)13(21)24-9-8-23-12(20)15(4,5)17/h7-10H2,1-6H3 |
| InChIKey | LSKUWVMXAHPPIJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|