C28H50Br2O7 — CID 161090750
tert-butyl 2-bromo-2,4,4-trimethyl-5-oxoheptanoate;tert-butyl 2-methylprop-2-enoate;ethyl 2-bromo-2-methylpropanoate (PubChem CID 161090750) has the molecular formula C28H50Br2O7 and a molecular weight of 658.51 g/mol. Its IUPAC name is tert-butyl 2-bromo-2,4,4-trimethyl-5-oxoheptanoate;tert-butyl 2-methylprop-2-enoate;ethyl 2-bromo-2-methylpropanoate.
| Compound Name | tert-butyl 2-bromo-2,4,4-trimethyl-5-oxoheptanoate;tert-butyl 2-methylprop-2-enoate;ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 161090750 |
| Molecular Formula | C28H50Br2O7 |
| Molecular Weight | 658.51 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | tert-butyl 2-bromo-2,4,4-trimethyl-5-oxoheptanoate;tert-butyl 2-methylprop-2-enoate;ethyl 2-bromo-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C.CCC(=O)C(C)(C)CC(C)(Br)C(=O)OC(C)(C)C.CCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C14H25BrO3.C8H14O2.C6H11BrO2/c1-8-10(16)13(5,6)9-14(7,15)11(17)18-12(2,3)4;1-6(2)7(9)10-8(3,4)5;1-4-9-5(8)6(2,3)7/h8-9H2,1-7H3;1H2,2-5H3;4H2,1-3H3 |
| InChIKey | UHDGNVCCAINZQC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|