C15H22Br2O8 — CID 14932665
tetraethyl 1,3-dibromopropane-1,1,3,3-tetracarboxylate (PubChem CID 14932665) has the molecular formula C15H22Br2O8 and a molecular weight of 490.14 g/mol. Its IUPAC name is tetraethyl 1,3-dibromopropane-1,1,3,3-tetracarboxylate.
| Compound Name | tetraethyl 1,3-dibromopropane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 14932665 |
| Molecular Formula | C15H22Br2O8 |
| Molecular Weight | 490.14 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | tetraethyl 1,3-dibromopropane-1,1,3,3-tetracarboxylate |
| SMILES | CCOC(=O)C(Br)(CC(Br)(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H22Br2O8/c1-5-22-10(18)14(16,11(19)23-6-2)9-15(17,12(20)24-7-3)13(21)25-8-4/h5-9H2,1-4H3 |
| InChIKey | WWRJFRXAXDRVOF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|