C16H25BrO9 — CID 71337466
tetraethyl 1-bromo-2-ethoxyethane-1,1,2,2-tetracarboxylate (PubChem CID 71337466) has the molecular formula C16H25BrO9 and a molecular weight of 441.27 g/mol. Its IUPAC name is tetraethyl 1-bromo-2-ethoxyethane-1,1,2,2-tetracarboxylate.
| Compound Name | tetraethyl 1-bromo-2-ethoxyethane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 71337466 |
| Molecular Formula | C16H25BrO9 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | tetraethyl 1-bromo-2-ethoxyethane-1,1,2,2-tetracarboxylate |
| SMILES | CCOC(=O)C(Br)(C(=O)OCC)C(OCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H25BrO9/c1-6-22-11(18)15(17,12(19)23-7-2)16(26-10-5,13(20)24-8-3)14(21)25-9-4/h6-10H2,1-5H3 |
| InChIKey | JJGPDDBCXYCGIE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|