About deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate
deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate (PubChem CID 157428087) has the molecular formula C10H20BBrO4
and a molecular weight of 295.99 g/mol. Its IUPAC name is deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate.
Molecular Properties
| Compound Name | deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate |
| PubChem CID | 157428087 |
| Molecular Formula | C10H20BBrO4 |
| Molecular Weight | 295.99 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(Br)C(=O)OCC.[2H]B(C)C |
| InChI | InChI=1S/C8H13BrO4.C2H7B/c1-4-12-6(10)8(3,9)7(11)13-5-2;1-3-2/h4-5H2,1-3H3;3H,1-2H3/i;3D |
| InChIKey | BQEUUKPCIBRJHK-UGQHUCJLSA-N |
| XLogP | 1.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.99 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate?
The IUPAC name of deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate (CID 157428087) is deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate.
What is the SMILES notation for deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate?
The canonical SMILES for deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate is CCOC(=O)C(C)(Br)C(=O)OCC.[2H]B(C)C.
What is the InChIKey of deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate?
The InChIKey is BQEUUKPCIBRJHK-UGQHUCJLSA-N. The full InChI is InChI=1S/C8H13BrO4.C2H7B/c1-4-12-6(10)8(3,9)7(11)13-5-2;1-3-2/h4-5H2,1-3H3;3H,1-2H3/i;3D.
What are the key properties of deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate?
deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate has a molecular weight of 295.99 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio(dimethyl)borane;diethyl 2-bromo-2-methylpropanedioate is sourced from PubChem (CID 157428087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).