C16H21BrO4 — CID 175600012
diethyl 2-bromo-2-[(3,5-dimethylphenyl)methyl]propanedioate (PubChem CID 175600012) has the molecular formula C16H21BrO4 and a molecular weight of 357.24 g/mol. Its IUPAC name is diethyl 2-bromo-2-[(3,5-dimethylphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-bromo-2-[(3,5-dimethylphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 175600012 |
| Molecular Formula | C16H21BrO4 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | diethyl 2-bromo-2-[(3,5-dimethylphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Br)(Cc1cc(C)cc(C)c1)C(=O)OCC |
| InChI | InChI=1S/C16H21BrO4/c1-5-20-14(18)16(17,15(19)21-6-2)10-13-8-11(3)7-12(4)9-13/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | RWUKAUUCUWGATF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|