C21H26O3 — CID 54018003
ethyl 2,2-bis(3,5-dimethylphenyl)-2-methoxyacetate (PubChem CID 54018003) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is ethyl 2,2-bis(3,5-dimethylphenyl)-2-methoxyacetate.
| Compound Name | ethyl 2,2-bis(3,5-dimethylphenyl)-2-methoxyacetate |
|---|---|
| PubChem CID | 54018003 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | ethyl 2,2-bis(3,5-dimethylphenyl)-2-methoxyacetate |
| SMILES | CCOC(=O)C(OC)(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H26O3/c1-7-24-20(22)21(23-6,18-10-14(2)8-15(3)11-18)19-12-16(4)9-17(5)13-19/h8-13H,7H2,1-6H3 |
| InChIKey | KWYBEHAQTRSXIK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |