C19H30O3 — CID 143309553
ethyl 2-(3,5-ditert-butylphenyl)-2-hydroxypropanoate (PubChem CID 143309553) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethyl 2-(3,5-ditert-butylphenyl)-2-hydroxypropanoate.
| Compound Name | ethyl 2-(3,5-ditert-butylphenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 143309553 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | ethyl 2-(3,5-ditert-butylphenyl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(C)(O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O3/c1-9-22-16(20)19(8,21)15-11-13(17(2,3)4)10-14(12-15)18(5,6)7/h10-12,21H,9H2,1-8H3 |
| InChIKey | HDUPUYZQDIVSBR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |