C10H17ClO3 — CID 123416365
(3-chloro-2,2-dimethyl-3-oxopropyl) 2,2-dimethylpropanoate (PubChem CID 123416365) has the molecular formula C10H17ClO3 and a molecular weight of 220.70 g/mol. Its IUPAC name is (3-chloro-2,2-dimethyl-3-oxopropyl) 2,2-dimethylpropanoate.
| Compound Name | (3-chloro-2,2-dimethyl-3-oxopropyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123416365 |
| Molecular Formula | C10H17ClO3 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (3-chloro-2,2-dimethyl-3-oxopropyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(C)(C)C(=O)Cl |
| InChI | InChI=1S/C10H17ClO3/c1-9(2,3)8(13)14-6-10(4,5)7(11)12/h6H2,1-5H3 |
| InChIKey | KDQNOZOFZZDCHK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|