About (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate
(2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate (PubChem CID 143779600) has the molecular formula C8H14F2O4S
and a molecular weight of 244.26 g/mol. Its IUPAC name is (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate.
Analyze (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate?
The IUPAC name of (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate (CID 143779600) is (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate.
What is the SMILES notation for (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate?
The canonical SMILES for (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCC(F)(F)S(C)(=O)=O.
What is the InChIKey of (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate?
The InChIKey is BHGZIQVEWOQXMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2O4S/c1-7(2,3)6(11)14-5-8(9,10)15(4,12)13/h5H2,1-4H3.
What are the key properties of (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate?
(2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate has a molecular weight of 244.26 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluoro-2-methylsulfonylethyl) 2,2-dimethylpropanoate is sourced from PubChem (CID 143779600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).