About [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium
[2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium (PubChem CID 123275050) has the molecular formula C8H15F2O5S+
and a molecular weight of 261.27 g/mol. Its IUPAC name is [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium.
Molecular Properties
| Compound Name | [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium |
| PubChem CID | 123275050 |
| Molecular Formula | C8H15F2O5S+ |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium |
| SMILES | CCC(C)(C)C(=O)OCC(F)(F)S(=O)(=O)[OH2+] |
| InChI | InChI=1S/C8H14F2O5S/c1-4-7(2,3)6(11)15-5-8(9,10)16(12,13)14/h4-5H2,1-3H3,(H,12,13,14)/p+1 |
| InChIKey | ARYXPUVHIMMKSC-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 83.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium?
The IUPAC name of [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium (CID 123275050) is [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium.
What is the SMILES notation for [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium?
The canonical SMILES for [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium is CCC(C)(C)C(=O)OCC(F)(F)S(=O)(=O)[OH2+].
What is the InChIKey of [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium?
The InChIKey is ARYXPUVHIMMKSC-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H14F2O5S/c1-4-7(2,3)6(11)15-5-8(9,10)16(12,13)14/h4-5H2,1-3H3,(H,12,13,14)/p+1.
What are the key properties of [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium?
[2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium has a molecular weight of 261.27 g/mol, XLogP of 0.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium is sourced from PubChem (CID 123275050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).