C8H15F2O5S+ — CID 123275050
[2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium (PubChem CID 123275050) has the molecular formula C8H15F2O5S+ and a molecular weight of 261.27 g/mol. Its IUPAC name is [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium.
| Compound Name | [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium |
|---|---|
| PubChem CID | 123275050 |
| Molecular Formula | C8H15F2O5S+ |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [2-(2,2-dimethylbutanoyloxy)-1,1-difluoroethyl]sulfonyloxidanium |
| SMILES | CCC(C)(C)C(=O)OCC(F)(F)S(=O)(=O)[OH2+] |
| InChI | InChI=1S/C8H14F2O5S/c1-4-7(2,3)6(11)15-5-8(9,10)16(12,13)14/h4-5H2,1-3H3,(H,12,13,14)/p+1 |
| InChIKey | ARYXPUVHIMMKSC-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 83.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|