C9H15F2NO7S — CID 118231775
2-(2,2-dimethylbutanoyloxycarbamoyloxy)-1,1-difluoroethanesulfonic acid (PubChem CID 118231775) has the molecular formula C9H15F2NO7S and a molecular weight of 319.28 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxycarbamoyloxy)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(2,2-dimethylbutanoyloxycarbamoyloxy)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 118231775 |
| Molecular Formula | C9H15F2NO7S |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxycarbamoyloxy)-1,1-difluoroethanesulfonic acid |
| SMILES | CCC(C)(C)C(=O)ONC(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H15F2NO7S/c1-4-8(2,3)6(13)19-12-7(14)18-5-9(10,11)20(15,16)17/h4-5H2,1-3H3,(H,12,14)(H,15,16,17) |
| InChIKey | ZVOHLYGHHZCTIG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|